2-(3,4-dihydroxyphenyl)ethyl (E,3R)-4-formyl-3-(2-oxoethyl)hex-4-enoate
Internal ID | 8e581b08-d4bd-427d-9195-9a62da0f1e4b |
Taxonomy | Benzenoids > Phenols > Tyrosols and derivatives |
IUPAC Name | 2-(3,4-dihydroxyphenyl)ethyl (E,3R)-4-formyl-3-(2-oxoethyl)hex-4-enoate |
SMILES (Canonical) | CC=C(C=O)C(CC=O)CC(=O)OCCC1=CC(=C(C=C1)O)O |
SMILES (Isomeric) | C/C=C(/C=O)\[C@H](CC=O)CC(=O)OCCC1=CC(=C(C=C1)O)O |
InChI | InChI=1S/C17H20O6/c1-2-13(11-19)14(5-7-18)10-17(22)23-8-6-12-3-4-15(20)16(21)9-12/h2-4,7,9,11,14,20-21H,5-6,8,10H2,1H3/b13-2-/t14-/m1/s1 |
InChI Key | XLPXUPOZUYGVPD-VJWXVMMXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H20O6 |
Molecular Weight | 320.30 g/mol |
Exact Mass | 320.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 101.00 Ų |
XlogP | 1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.69% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.88% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.87% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.70% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.53% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.62% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.76% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.11% | 91.19% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.86% | 95.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.79% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.08% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.52% | 96.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.18% | 94.62% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.12% | 96.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.90% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 81.70% | 90.71% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.57% | 100.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.14% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.00% | 99.15% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.93% | 97.21% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.69% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Olea europaea |
PubChem | 163190671 |
LOTUS | LTS0184440 |
wikiData | Q105330188 |