2-(3,4-Dihydroxyphenyl)-8,11-dihydroxynaphtho[2,1-f]chromen-9-one
| Internal ID | 0c4f9692-3bd7-4dec-bc42-531c828c3e23 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Hydroxyflavonoids > 7-hydroxyflavonoids |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-8,11-dihydroxynaphtho[2,1-f]chromen-9-one |
| SMILES (Canonical) | C1=CC(=C(C=C1C2=CC=C3C4=CC=C5C=C(C(=O)C=C5C4=C(C=C3O2)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1C2=CC=C3C4=CC=C5C=C(C(=O)C=C5C4=C(C=C3O2)O)O)O)O |
| InChI | InChI=1S/C23H14O6/c24-16-5-2-12(8-17(16)25)21-6-4-13-14-3-1-11-7-18(26)19(27)9-15(11)23(14)20(28)10-22(13)29-21/h1-10,24-26,28H |
| InChI Key | UNNQZEIHWOHJBT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H14O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
![2D Structure of 2-(3,4-Dihydroxyphenyl)-8,11-dihydroxynaphtho[2,1-f]chromen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-34-dihydroxyphenyl-811-dihydroxynaphtho21-fchromen-9-one.jpg "2D Structure of 2-(3,4-Dihydroxyphenyl)-8,11-dihydroxynaphtho[2,1-f]chromen-9-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.95% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.83% | 99.15% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.12% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.33% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.28% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.70% | 94.00% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 91.24% | 93.24% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 90.65% | 80.78% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.67% | 86.33% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 89.28% | 85.30% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 88.97% | 95.20% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.21% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.46% | 98.95% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.92% | 93.65% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 86.13% | 80.96% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 84.89% | 83.10% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.65% | 99.23% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 83.86% | 83.57% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.64% | 90.71% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 81.81% | 89.23% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.67% | 91.38% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 80.95% | 89.49% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.61% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sphagnum magellanicum |
| PubChem | 71438409 |
| LOTUS | LTS0260685 |
| wikiData | Q104252143 |