2-[[3,4-Dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-(4-prop-2-enylphenoxy)oxane-3,4,5-triol
Internal ID | 4f985a55-d74e-447c-8c85-6edbf04fb04b |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 2-[[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-(4-prop-2-enylphenoxy)oxane-3,4,5-triol |
SMILES (Canonical) | C=CCC1=CC=C(C=C1)OC2C(C(C(C(O2)COC3C(C(CO3)(CO)O)O)O)O)O |
SMILES (Isomeric) | C=CCC1=CC=C(C=C1)OC2C(C(C(C(O2)COC3C(C(CO3)(CO)O)O)O)O)O |
InChI | InChI=1S/C20H28O10/c1-2-3-11-4-6-12(7-5-11)29-18-16(24)15(23)14(22)13(30-18)8-27-19-17(25)20(26,9-21)10-28-19/h2,4-7,13-19,21-26H,1,3,8-10H2 |
InChI Key | HLTAEJNADMCLOV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O10 |
Molecular Weight | 428.40 g/mol |
Exact Mass | 428.16824709 g/mol |
Topological Polar Surface Area (TPSA) | 158.00 Ų |
XlogP | -0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.57% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.27% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.02% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.12% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.65% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.89% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.00% | 94.00% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 85.80% | 83.57% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.96% | 95.56% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 83.79% | 97.78% |
CHEMBL2581 | P07339 | Cathepsin D | 83.44% | 98.95% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.71% | 95.83% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.66% | 92.94% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.14% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.27% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.19% | 94.73% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.75% | 90.24% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.39% | 92.32% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.19% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Betula papyrifera |
Viburnum furcatum |
PubChem | 4484392 |
LOTUS | LTS0111188 |
wikiData | Q105030281 |