2-(3-Methoxy-4-prop-2-enylphenyl)-4-prop-2-enylphenol
| Internal ID | d7cfbe72-de6e-4f59-9562-971678f980a2 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
| IUPAC Name | 2-(3-methoxy-4-prop-2-enylphenyl)-4-prop-2-enylphenol |
| SMILES (Canonical) | COC1=C(C=CC(=C1)C2=C(C=CC(=C2)CC=C)O)CC=C |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)C2=C(C=CC(=C2)CC=C)O)CC=C |
| InChI | InChI=1S/C19H20O2/c1-4-6-14-8-11-18(20)17(12-14)16-10-9-15(7-5-2)19(13-16)21-3/h4-5,8-13,20H,1-2,6-7H2,3H3 |
| InChI Key | OZYSBTCLTQLPGH-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 5.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.16% | 95.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.61% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.80% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.56% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.57% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.44% | 86.33% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 90.71% | 90.24% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 90.03% | 98.11% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.03% | 95.50% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 87.91% | 95.12% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.27% | 96.95% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.27% | 88.48% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.21% | 94.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.64% | 91.49% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.64% | 90.20% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.46% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 83.80% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.00% | 95.89% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.74% | 80.78% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.00% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Magnolia obovata |
| PubChem | 160146402 |
| LOTUS | LTS0213431 |
| wikiData | Q105204267 |