2-(3-Hydroxy-5-methoxyphenyl)-1-benzofuran-4-ol
Internal ID | 0ac559d2-7133-4016-a537-5daae97f10a7 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 2-(3-hydroxy-5-methoxyphenyl)-1-benzofuran-4-ol |
SMILES (Canonical) | COC1=CC(=CC(=C1)O)C2=CC3=C(C=CC=C3O2)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1)O)C2=CC3=C(C=CC=C3O2)O |
InChI | InChI=1S/C15H12O4/c1-18-11-6-9(5-10(16)7-11)15-8-12-13(17)3-2-4-14(12)19-15/h2-8,16-17H,1H3 |
InChI Key | LNYJPSJEXBTRPO-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C15H12O4 |
Molecular Weight | 256.25 g/mol |
Exact Mass | 256.07355886 g/mol |
Topological Polar Surface Area (TPSA) | 62.80 Ų |
XlogP | 3.20 |
439900-84-2 |
2-(3-hydroxy-5-methoxyphenyl)-1-benzofuran-4-ol |
STEMOFURAN B |
4-benzofuranol, 2-(3-hydroxy-5-methoxyphenyl)- |
CHEMBL511197 |
HY-N10779 |
AKOS040734903 |
FS-7753 |
CS-0636026 |
InChI=1/C15H12O4/c1-18-11-6-9(5-10(16)7-11)15-8-12-13(17)3-2-4-14(12)19-15/h2-8,16-17H,1H |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.96% | 91.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.90% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 93.82% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.46% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.09% | 95.56% |
CHEMBL240 | Q12809 | HERG | 91.62% | 89.76% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.30% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.11% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.75% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.20% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 86.16% | 98.75% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.77% | 93.31% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.42% | 93.65% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 84.32% | 100.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.62% | 93.99% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.46% | 91.49% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 82.28% | 92.08% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.18% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.10% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gnetum montanum |
Stemona collinsae |
PubChem | 641364 |
LOTUS | LTS0083072 |
wikiData | Q105154574 |