Stemofuran D
| Internal ID | 1ecb423c-24e3-4318-addf-f1c2d831590f |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 2-(3-hydroxy-5-methoxy-2-methylphenyl)-1-benzofuran-4-ol |
| SMILES (Canonical) | CC1=C(C=C(C=C1O)OC)C2=CC3=C(C=CC=C3O2)O |
| SMILES (Isomeric) | CC1=C(C=C(C=C1O)OC)C2=CC3=C(C=CC=C3O2)O |
| InChI | InChI=1S/C16H14O4/c1-9-11(6-10(19-2)7-14(9)18)16-8-12-13(17)4-3-5-15(12)20-16/h3-8,17-18H,1-2H3 |
| InChI Key | GUQBHRSHFCOITG-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 62.80 Ų |
| XlogP | 3.60 |
| CHEMBL464901 |
| 2-(3-hydroxy-5-methoxy-2-methylphenyl)-1-benzofuran-4-ol |
| 4-benzofuranol, 2-(3-hydroxy-5-methoxy-2-methylphenyl)- |
| InChI=1/C16H14O4/c1-9-11(6-10(19-2)7-14(9)18)16-8-12-13(17)4-3-5-15(12)20-16/h3-8,17-18H,1-2H |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.79% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.28% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.69% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.96% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.14% | 98.95% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 89.72% | 93.65% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.10% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.00% | 89.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.69% | 93.31% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.27% | 94.73% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 86.24% | 98.35% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.12% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.98% | 99.23% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.35% | 100.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.88% | 93.99% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 81.57% | 94.67% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.01% | 90.24% |
| CHEMBL240 | Q12809 | HERG | 80.75% | 89.76% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Stemona collinsae |
| PubChem | 641366 |
| LOTUS | LTS0126391 |
| wikiData | Q105020361 |