2-(3-Hydroxy-4,5-dimethoxyphenyl)chromen-4-one
Internal ID | 0fa6f6d9-e4b3-4a60-a824-825b0e947366 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 4-O-methylated flavonoids |
IUPAC Name | 2-(3-hydroxy-4,5-dimethoxyphenyl)chromen-4-one |
SMILES (Canonical) | COC1=CC(=CC(=C1OC)O)C2=CC(=O)C3=CC=CC=C3O2 |
SMILES (Isomeric) | COC1=CC(=CC(=C1OC)O)C2=CC(=O)C3=CC=CC=C3O2 |
InChI | InChI=1S/C17H14O5/c1-20-16-8-10(7-13(19)17(16)21-2)15-9-12(18)11-5-3-4-6-14(11)22-15/h3-9,19H,1-2H3 |
InChI Key | BXZGAEJNHQEGIY-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C17H14O5 |
Molecular Weight | 298.29 g/mol |
Exact Mass | 298.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 3.10 |
CHEBI:193351 |
2-(3-hydroxy-4,5-dimethoxyphenyl)chromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.12% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.31% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.86% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.02% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.71% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 90.21% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.36% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.35% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.48% | 93.99% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.80% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 82.36% | 98.75% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.44% | 80.78% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.87% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 80.79% | 90.20% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.49% | 92.62% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.49% | 93.65% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.18% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Primula veris |
PubChem | 25189612 |
LOTUS | LTS0100332 |
wikiData | Q104949029 |