2-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol
| Internal ID | 2b5b034d-edc5-426e-98f6-b02ab3fed095 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 4-O-methylated flavonoids |
| IUPAC Name | 2-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C2CCC3=C(O2)C=C(C=C3)O)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C2CCC3=C(O2)C=C(C=C3)O)O |
| InChI | InChI=1S/C16H16O4/c1-19-15-7-4-11(8-13(15)18)14-6-3-10-2-5-12(17)9-16(10)20-14/h2,4-5,7-9,14,17-18H,3,6H2,1H3 |
| InChI Key | KGTOSQKIOMIICT-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.10 |
| 2-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| CHEMBL2017115 |
| 2H-1-Benzopyran-7-ol, 3,4-dihydro-2-(3-hydroxy-4-methoxyphenyl)- |
| (2S)-7,3'-Dihydroxy-4'-methoxyflavane |
| SCHEMBL1245170 |
| DTXSID60458442 |
| CHEBI:180153 |
| 2H-1-Benzopyran-7-ol, 3,4-dihydro-2-(3-hydroxy-4-methoxyphenyl)-, (S)-; (2S)-3,4-Dihydro-2-(3-hydroxy-4-methoxyphenyl)-2H-1-benzopyran-7-ol; (2S)-3',7-Dihydroxy-4'-methoxyflavan; (2S)-3',7-Dihydroxy-4'-methoxyflavan |
| BDBM50380998 |
| AKOS032948871 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.85% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.07% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.72% | 91.49% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 93.34% | 91.79% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.49% | 92.94% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 92.28% | 95.78% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.02% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.29% | 95.89% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.63% | 95.89% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 90.52% | 88.48% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.00% | 95.56% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 87.95% | 82.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.30% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.60% | 93.99% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.08% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.97% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.40% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.22% | 90.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 82.60% | 95.62% |
| CHEMBL3194 | P02766 | Transthyretin | 81.97% | 90.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.46% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Brosimum acutifolium |
| Crinum asiaticum |
| Dracaena cinnabari |
| Habranthus brachyandrus |
| PubChem | 11196546 |
| LOTUS | LTS0265328 |
| wikiData | Q82281712 |