2-(2,4-dimethoxyphenyl)-5-[(E)-prop-1-enyl]-1-benzofuran
| Internal ID | 53d2b6b4-407d-48b8-b717-6f445399c011 |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-5-[(E)-prop-1-enyl]-1-benzofuran |
| SMILES (Canonical) | CC=CC1=CC2=C(C=C1)OC(=C2)C3=C(C=C(C=C3)OC)OC |
| SMILES (Isomeric) | C/C=C/C1=CC2=C(C=C1)OC(=C2)C3=C(C=C(C=C3)OC)OC |
| InChI | InChI=1S/C19H18O3/c1-4-5-13-6-9-17-14(10-13)11-19(22-17)16-8-7-15(20-2)12-18(16)21-3/h4-12H,1-3H3/b5-4+ |
| InChI Key | DIOUMFOJMGVIPQ-SNAWJCMRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.125594432 g/mol |
| Topological Polar Surface Area (TPSA) | 31.60 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
![2D Structure of 2-(2,4-dimethoxyphenyl)-5-[(E)-prop-1-enyl]-1-benzofuran](https://plantaedb.com/storage/docs/compounds/2023/11/2-24-dimethoxyphenyl-5-e-prop-1-enyl-1-benzofuran.jpg "2D Structure of 2-(2,4-dimethoxyphenyl)-5-[(E)-prop-1-enyl]-1-benzofuran")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.61% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.58% | 91.11% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 95.02% | 93.31% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.04% | 95.56% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 93.01% | 90.24% |
| CHEMBL2487 | P05067 | Beta amyloid A4 protein | 93.00% | 96.74% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.40% | 86.33% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 89.35% | 95.12% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.54% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.90% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.65% | 99.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.32% | 92.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.43% | 98.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.41% | 97.21% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.27% | 89.62% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 80.14% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Krameria bicolor |
| Krameria erecta |
| Krameria ramosissima |
| PubChem | 13834121 |
| LOTUS | LTS0075375 |
| wikiData | Q104981545 |