2-(2,4-Dihydroxyphenyl)-5,6-dimethoxybenzofuran
Internal ID | ee89a525-11cb-41a3-9934-8039f9cc8625 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 4-(5,6-dimethoxy-1-benzofuran-2-yl)benzene-1,3-diol |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C=C(O2)C3=C(C=C(C=C3)O)O)OC |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)C=C(O2)C3=C(C=C(C=C3)O)O)OC |
InChI | InChI=1S/C16H14O5/c1-19-15-6-9-5-14(21-13(9)8-16(15)20-2)11-4-3-10(17)7-12(11)18/h3-8,17-18H,1-2H3 |
InChI Key | TTWXNRBRBJPLQH-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C16H14O5 |
Molecular Weight | 286.28 g/mol |
Exact Mass | 286.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 72.10 Ų |
XlogP | 3.20 |
2',4'-Dihydroxy-5,6-dimethoxy-2-phenylbenzofuran |
CHEBI:174728 |
DTXSID101237871 |
LMPK12160043 |
4-(5,6-Dimethoxy-2-benzofuranyl)-1,3-benzenediol |
4-(5,6-dimethoxy-1-benzouran-2-yl)benzene-1,3-diol |
67492-33-5 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.03% | 91.11% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 94.14% | 98.35% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.83% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.52% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.95% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 88.98% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.69% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.30% | 99.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.87% | 92.94% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.78% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 84.28% | 98.75% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.57% | 89.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.17% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.16% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.80% | 96.09% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.76% | 90.24% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.05% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Myroxylon balsamum |
PubChem | 44260110 |
LOTUS | LTS0078013 |
wikiData | Q105264545 |