2-((2,4-Dihydroxybenzoyl)amino)-4-methoxybenzoic acid
| Internal ID | e56f6bbc-d6a7-48ca-89e8-ee2923933aca |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Anilides > Aromatic anilides > Benzanilides |
| IUPAC Name | 2-[(2,4-dihydroxybenzoyl)amino]-4-methoxybenzoic acid |
| SMILES (Canonical) | COC1=CC(=C(C=C1)C(=O)O)NC(=O)C2=C(C=C(C=C2)O)O |
| SMILES (Isomeric) | COC1=CC(=C(C=C1)C(=O)O)NC(=O)C2=C(C=C(C=C2)O)O |
| InChI | InChI=1S/C15H13NO6/c1-22-9-3-5-10(15(20)21)12(7-9)16-14(19)11-4-2-8(17)6-13(11)18/h2-7,17-18H,1H3,(H,16,19)(H,20,21) |
| InChI Key | GLXWWDVTVBGZGZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H13NO6 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.07428713 g/mol |
| Topological Polar Surface Area (TPSA) | 116.00 Ų |
| XlogP | 2.60 |
| 2-((2,4-Dihydroxybenzoyl)amino)-4-methoxybenzoic acid |
| DTXSID60151148 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 98.49% | 97.36% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 98.18% | 87.67% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 97.59% | 81.11% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.69% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.16% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.96% | 96.09% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 93.80% | 94.42% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.69% | 99.15% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.51% | 91.07% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.68% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.40% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.39% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.60% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.72% | 91.19% |
| CHEMBL3194 | P02766 | Transthyretin | 83.64% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.82% | 94.45% |
| CHEMBL4901 | P54753 | Ephrin type-B receptor 3 | 81.81% | 87.50% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.97% | 95.50% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.84% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.36% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dianthus caryophyllus |
| PubChem | 189309 |
| LOTUS | LTS0136305 |
| wikiData | Q83017551 |