2-[(2,4-Dihydroxybenzoyl)amino]-4-hydroxybenzoic acid
| Internal ID | 5c2d6e99-7550-4300-bd9a-6de92902b5e1 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Anilides > Aromatic anilides > Benzanilides |
| IUPAC Name | 2-[(2,4-dihydroxybenzoyl)amino]-4-hydroxybenzoic acid |
| SMILES (Canonical) | C1=CC(=C(C=C1O)NC(=O)C2=C(C=C(C=C2)O)O)C(=O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1O)NC(=O)C2=C(C=C(C=C2)O)O)C(=O)O |
| InChI | InChI=1S/C14H11NO6/c16-7-1-3-9(14(20)21)11(5-7)15-13(19)10-4-2-8(17)6-12(10)18/h1-6,16-18H,(H,15,19)(H,20,21) |
| InChI Key | RGHQZWPJNRDCCH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H11NO6 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.05863707 g/mol |
| Topological Polar Surface Area (TPSA) | 127.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
![2D Structure of 2-[(2,4-Dihydroxybenzoyl)amino]-4-hydroxybenzoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/2-24-dihydroxybenzoylamino-4-hydroxybenzoic-acid.jpg "2D Structure of 2-[(2,4-Dihydroxybenzoyl)amino]-4-hydroxybenzoic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 97.18% | 81.11% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 97.03% | 87.67% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 96.27% | 97.36% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 91.82% | 94.42% |
| CHEMBL3194 | P02766 | Transthyretin | 91.01% | 90.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.31% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.06% | 95.56% |
| CHEMBL4901 | P54753 | Ephrin type-B receptor 3 | 86.36% | 87.50% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.87% | 99.15% |
| CHEMBL2568 | P06737 | Liver glycogen phosphorylase | 84.76% | 96.92% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.52% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.36% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.01% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.63% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.57% | 90.71% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.18% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dianthus caryophyllus |
| PubChem | 9971390 |
| LOTUS | LTS0111438 |
| wikiData | Q105235855 |