2-(2-Methoxy-5-prop-1-enylphenyl)-4-prop-1-enylphenol
| Internal ID | e59737de-bdc5-491d-9bf1-0dbc0bd7f40e |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
| IUPAC Name | 2-(2-methoxy-5-prop-1-enylphenyl)-4-prop-1-enylphenol |
| SMILES (Canonical) | CC=CC1=CC(=C(C=C1)O)C2=C(C=CC(=C2)C=CC)OC |
| SMILES (Isomeric) | CC=CC1=CC(=C(C=C1)O)C2=C(C=CC(=C2)C=CC)OC |
| InChI | InChI=1S/C19H20O2/c1-4-6-14-8-10-18(20)16(12-14)17-13-15(7-5-2)9-11-19(17)21-3/h4-13,20H,1-3H3 |
| InChI Key | NKOCCEDSXFBRQY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 5.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.82% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.20% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 94.44% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.64% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.01% | 96.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 91.58% | 90.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.49% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.00% | 90.20% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.08% | 96.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.25% | 89.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.09% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.91% | 90.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 84.28% | 98.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.78% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.15% | 89.00% |
| CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 81.52% | 83.65% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.84% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Magnolia obovata |
| PubChem | 163022116 |
| LOTUS | LTS0157049 |
| wikiData | Q105033400 |