2-[(2-Hydroxybenzoyl)amino]benzoic acid
| Internal ID | a9b26248-a9fb-4f5c-afc1-3844b284dbec |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Anilides > Aromatic anilides > Benzanilides |
| IUPAC Name | 2-[(2-hydroxybenzoyl)amino]benzoic acid |
| SMILES (Canonical) | C1=CC=C(C(=C1)C(=O)O)NC(=O)C2=CC=CC=C2O |
| SMILES (Isomeric) | C1=CC=C(C(=C1)C(=O)O)NC(=O)C2=CC=CC=C2O |
| InChI | InChI=1S/C14H11NO4/c16-12-8-4-2-6-10(12)13(17)15-11-7-3-1-5-9(11)14(18)19/h1-8,16H,(H,15,17)(H,18,19) |
| InChI Key | CDKACLITEIDAIS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.06880783 g/mol |
| Topological Polar Surface Area (TPSA) | 86.60 Ų |
| XlogP | 3.30 |
| 13316-98-8 |
| Benzoic acid, 2-[(2-hydroxybenzoyl)amino]- |
| N-Salicyloylanthranilic acid |
| SCHEMBL4669122 |
| SCHEMBL11405554 |
| DTXSID20332638 |
| AKOS000127375 |
![2D Structure of 2-[(2-Hydroxybenzoyl)amino]benzoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/2-2-hydroxybenzoylaminobenzoic-acid.jpg "2D Structure of 2-[(2-Hydroxybenzoyl)amino]benzoic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 97.45% | 87.67% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 95.08% | 81.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.35% | 95.56% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.07% | 94.62% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.97% | 97.36% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.03% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.33% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.22% | 90.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.27% | 98.75% |
| CHEMBL5847 | P52895 | Aldo-keto reductase family 1 member C2 | 84.18% | 92.50% |
| CHEMBL4901 | P54753 | Ephrin type-B receptor 3 | 83.79% | 87.50% |
| CHEMBL2321614 | Q9NPC2 | Potassium channel subfamily K member 9 | 83.77% | 80.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.21% | 95.50% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 81.81% | 85.83% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.13% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dianthus caryophyllus |
| PubChem | 459348 |
| LOTUS | LTS0197413 |
| wikiData | Q82097388 |