2-[1,7-Bis(3,4-dihydroxyphenyl)heptan-3-yloxy]oxane-3,4,5-triol
Internal ID | a33621e8-f77b-4cc9-82f2-9051c8d23474 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | 2-[1,7-bis(3,4-dihydroxyphenyl)heptan-3-yloxy]oxane-3,4,5-triol |
SMILES (Canonical) | C1C(C(C(C(O1)OC(CCCCC2=CC(=C(C=C2)O)O)CCC3=CC(=C(C=C3)O)O)O)O)O |
SMILES (Isomeric) | C1C(C(C(C(O1)OC(CCCCC2=CC(=C(C=C2)O)O)CCC3=CC(=C(C=C3)O)O)O)O)O |
InChI | InChI=1S/C24H32O9/c25-17-9-6-14(11-19(17)27)3-1-2-4-16(8-5-15-7-10-18(26)20(28)12-15)33-24-23(31)22(30)21(29)13-32-24/h6-7,9-12,16,21-31H,1-5,8,13H2 |
InChI Key | PVCSOVFCVIEUFH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H32O9 |
Molecular Weight | 464.50 g/mol |
Exact Mass | 464.20463259 g/mol |
Topological Polar Surface Area (TPSA) | 160.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.88% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 93.72% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.63% | 96.09% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.49% | 95.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.30% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.81% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.36% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.81% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.06% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.93% | 95.93% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 84.83% | 96.37% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.72% | 94.73% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.39% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 82.84% | 98.75% |
CHEMBL3891 | P07384 | Calpain 1 | 80.50% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alnus firma |
Alnus hirsuta |
Alnus japonica |
PubChem | 74202880 |
LOTUS | LTS0042784 |
wikiData | Q105215390 |