2-[1-Hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-yl]oxyoxane-3,4,5-triol
| Internal ID | bd50fa90-4c83-4244-85a2-50a8b59317f1 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 2-[1-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-yl]oxyoxane-3,4,5-triol |
| SMILES (Canonical) | CC1CC(CC(C1CCC(CO)OC2C(C(C(CO2)O)O)O)(C)C)O |
| SMILES (Isomeric) | CC1CC(CC(C1CCC(CO)OC2C(C(C(CO2)O)O)O)(C)C)O |
| InChI | InChI=1S/C18H34O7/c1-10-6-11(20)7-18(2,3)13(10)5-4-12(8-19)25-17-16(23)15(22)14(21)9-24-17/h10-17,19-23H,4-9H2,1-3H3 |
| InChI Key | FSMSNKQMSSKYBN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H34O7 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.23045342 g/mol |
| Topological Polar Surface Area (TPSA) | 120.00 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
![2D Structure of 2-[1-Hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-yl]oxyoxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/2-1-hydroxy-4-4-hydroxy-226-trimethylcyclohexylbutan-2-yloxyoxane-345-triol.jpg "2D Structure of 2-[1-Hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butan-2-yl]oxyoxane-3,4,5-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.67% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.98% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.06% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.23% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.21% | 95.93% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 85.48% | 97.64% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.95% | 96.95% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.07% | 96.47% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.41% | 98.95% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.02% | 98.75% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.38% | 97.79% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.33% | 83.82% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.04% | 97.14% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.94% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Distimake guerichii |
| Sedum sarmentosum |
| PubChem | 74065293 |
| LOTUS | LTS0167821 |
| wikiData | Q105025107 |