2-[1-(4-Hydroxy-3-methoxyphenyl)propan-2-yl]-6-methoxy-4-prop-2-enylphenol
Internal ID | 7ccad202-783b-4752-b5c2-9273d4105c99 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 2-[1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]-6-methoxy-4-prop-2-enylphenol |
SMILES (Canonical) | CC(CC1=CC(=C(C=C1)O)OC)C2=C(C(=CC(=C2)CC=C)OC)O |
SMILES (Isomeric) | CC(CC1=CC(=C(C=C1)O)OC)C2=C(C(=CC(=C2)CC=C)OC)O |
InChI | InChI=1S/C20H24O4/c1-5-6-14-10-16(20(22)19(12-14)24-4)13(2)9-15-7-8-17(21)18(11-15)23-3/h5,7-8,10-13,21-22H,1,6,9H2,2-4H3 |
InChI Key | YHTNVFLIVNQHLW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H24O4 |
Molecular Weight | 328.40 g/mol |
Exact Mass | 328.16745924 g/mol |
Topological Polar Surface Area (TPSA) | 58.90 Ų |
XlogP | 4.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.25% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.33% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.87% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.68% | 94.45% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 91.60% | 90.20% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.33% | 99.17% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.29% | 95.17% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 90.64% | 98.11% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.05% | 90.24% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.65% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.28% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.03% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.08% | 99.15% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.20% | 92.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.61% | 94.73% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.34% | 89.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.48% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Myristica fragrans |
PubChem | 162848902 |
LOTUS | LTS0046896 |
wikiData | Q105348613 |