(1S,9R,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-2-ene
| Internal ID | 690724ee-ead4-45e1-95ac-003b56b807c8 |
| Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Sparteine, lupanine, and related alkaloids |
| IUPAC Name | (1S,9R,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-2-ene |
| SMILES (Canonical) | C1CCN2CC3CC(C2C1)CN4C3=CCCC4 |
| SMILES (Isomeric) | C1CCN2C[C@@H]3C[C@@H]([C@@H]2C1)CN4C3=CCCC4 |
| InChI | InChI=1S/C15H24N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h5,12-13,15H,1-4,6-11H2/t12-,13+,15-/m0/s1 |
| InChI Key | YIHBNZCJQJSZJP-GUTXKFCHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.193948774 g/mol |
| Topological Polar Surface Area (TPSA) | 6.50 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
![2D Structure of (1S,9R,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-2-ene](https://plantaedb.com/storage/docs/compounds/2023/11/1s9r10s-715-diazatetracyclo77102701015heptadec-2-ene.jpg "2D Structure of (1S,9R,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-2-ene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.07% | 97.09% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.88% | 93.40% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.36% | 97.25% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.98% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.29% | 98.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.62% | 93.56% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.83% | 90.24% |
| CHEMBL238 | Q01959 | Dopamine transporter | 85.67% | 95.88% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.00% | 95.89% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 84.93% | 98.33% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.80% | 93.04% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.33% | 96.09% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 83.78% | 91.81% |
| CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 82.70% | 95.61% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.66% | 94.78% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 82.54% | 96.67% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.08% | 99.18% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.58% | 82.69% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 81.38% | 97.98% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.98% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lupinus excubitus |
| PubChem | 162916756 |
| LOTUS | LTS0172180 |
| wikiData | Q105348834 |