(1S,5R,6S,7S,10R)-4,10-dimethyl-7-propan-2-yltricyclo[4.4.0.01,5]dec-3-ene
Internal ID | c98f90e8-30c9-4af0-844e-6bfffc75a7a8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (1S,5R,6S,7S,10R)-4,10-dimethyl-7-propan-2-yltricyclo[4.4.0.01,5]dec-3-ene |
SMILES (Canonical) | CC1CCC(C2C13C2C(=CC3)C)C(C)C |
SMILES (Isomeric) | C[C@@H]1CC[C@H]([C@@H]2[C@@]13[C@H]2C(=CC3)C)C(C)C |
InChI | InChI=1S/C15H24/c1-9(2)12-6-5-11(4)15-8-7-10(3)13(15)14(12)15/h7,9,11-14H,5-6,8H2,1-4H3/t11-,12+,13+,14+,15-/m1/s1 |
InChI Key | XUEHVOLRMXNRKQ-CAEXGNQWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24 |
Molecular Weight | 204.35 g/mol |
Exact Mass | 204.187800766 g/mol |
Topological Polar Surface Area (TPSA) | 0.00 Ų |
XlogP | 4.50 |
There are no found synonyms. |
![2D Structure of (1S,5R,6S,7S,10R)-4,10-dimethyl-7-propan-2-yltricyclo[4.4.0.01,5]dec-3-ene 2D Structure of (1S,5R,6S,7S,10R)-4,10-dimethyl-7-propan-2-yltricyclo[4.4.0.01,5]dec-3-ene](https://plantaedb.com/storage/docs/compounds/2023/11/1s5r6s7s10r-410-dimethyl-7-propan-2-yltricyclo440015dec-3-ene.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 90.78% | 86.00% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 89.29% | 97.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.98% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.00% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.78% | 89.62% |
CHEMBL4072 | P07858 | Cathepsin B | 87.32% | 93.67% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.34% | 96.43% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.82% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.33% | 95.89% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.52% | 96.47% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.47% | 94.80% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.33% | 93.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.92% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.46% | 94.75% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.18% | 90.24% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.17% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solidago canadensis |
PubChem | 101454443 |
LOTUS | LTS0101150 |
wikiData | Q105342172 |