(1S,2S,4S,5R)-1,8-Epoxy-p-menthane-2,5-diol
Internal ID | b0289047-d4ff-4c15-b57b-a6f7d0e2653f |
Taxonomy | Organoheterocyclic compounds > Oxanes |
IUPAC Name | 1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane-5,7-diol |
SMILES (Canonical) | CC1(C2CC(C(O1)(CC2O)C)O)C |
SMILES (Isomeric) | CC1(C2CC(C(O1)(CC2O)C)O)C |
InChI | InChI=1S/C10H18O3/c1-9(2)6-4-8(12)10(3,13-9)5-7(6)11/h6-8,11-12H,4-5H2,1-3H3 |
InChI Key | RLNNVCTYJJOQLN-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C10H18O3 |
Molecular Weight | 186.25 g/mol |
Exact Mass | 186.125594432 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 0.20 |
1,8-Epoxy-p-menthane-2,5-diol |
CHEBI:171975 |
1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane-5,7-diol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.44% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.55% | 97.09% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 92.11% | 97.64% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.88% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.18% | 100.00% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.55% | 95.58% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.52% | 97.79% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.30% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.10% | 91.11% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.53% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Foeniculum vulgare |
PubChem | 85195105 |
LOTUS | LTS0186947 |
wikiData | Q105240360 |