(1S)-6-methoxy-1-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-7-ol
Internal ID | 61b2ed2a-8982-4f45-a9e8-93703b1c6a94 |
Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Benzylisoquinolines |
IUPAC Name | (1S)-6-methoxy-1-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-7-ol |
SMILES (Canonical) | COC1=CC=C(C=C1)CC2C3=CC(=C(C=C3CCN2)OC)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)C[C@H]2C3=CC(=C(C=C3CCN2)OC)O |
InChI | InChI=1S/C18H21NO3/c1-21-14-5-3-12(4-6-14)9-16-15-11-17(20)18(22-2)10-13(15)7-8-19-16/h3-6,10-11,16,19-20H,7-9H2,1-2H3/t16-/m0/s1 |
InChI Key | XIEZJSPLHXEHSK-INIZCTEOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C18H21NO3 |
Molecular Weight | 299.40 g/mol |
Exact Mass | 299.15214353 g/mol |
Topological Polar Surface Area (TPSA) | 50.70 Ų |
XlogP | 2.90 |
There are no found synonyms. |
![2D Structure of (1S)-6-methoxy-1-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-7-ol 2D Structure of (1S)-6-methoxy-1-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-7-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1s-6-methoxy-1-4-methoxyphenylmethyl-1234-tetrahydroisoquinolin-7-ol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.82% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.49% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.43% | 94.45% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.94% | 93.99% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.84% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.95% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.50% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.40% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.19% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.12% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.74% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.12% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.98% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 88.03% | 98.75% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.27% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.14% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.77% | 96.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.28% | 86.33% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.64% | 91.03% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.33% | 99.15% |
CHEMBL3820 | P35557 | Hexokinase type IV | 81.18% | 91.96% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.59% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Xylopia parviflora |
PubChem | 24944443 |
LOTUS | LTS0261808 |
wikiData | Q105328441 |