(1R,5R,7S,10S,11S)-5,7-dimethyl-2,6-dioxa-15-azatetracyclo[8.7.0.03,8.011,15]heptadec-3(8)-en-9-one
Internal ID | fa22d170-3794-43f1-90f5-a6d6bbaa466f |
Taxonomy | Organoheterocyclic compounds > Indolizidines |
IUPAC Name | (1R,5R,7S,10S,11S)-5,7-dimethyl-2,6-dioxa-15-azatetracyclo[8.7.0.03,8.011,15]heptadec-3(8)-en-9-one |
SMILES (Canonical) | CC1CC2=C(C(O1)C)C(=O)C3C4CCCN4CCC3O2 |
SMILES (Isomeric) | C[C@@H]1CC2=C([C@@H](O1)C)C(=O)[C@H]3[C@@H]4CCCN4CC[C@H]3O2 |
InChI | InChI=1S/C16H23NO3/c1-9-8-13-14(10(2)19-9)16(18)15-11-4-3-6-17(11)7-5-12(15)20-13/h9-12,15H,3-8H2,1-2H3/t9-,10+,11+,12-,15+/m1/s1 |
InChI Key | LWWZGVZQUUYUFN-KYSMWIMPSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C16H23NO3 |
Molecular Weight | 277.36 g/mol |
Exact Mass | 277.16779360 g/mol |
Topological Polar Surface Area (TPSA) | 38.80 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of (1R,5R,7S,10S,11S)-5,7-dimethyl-2,6-dioxa-15-azatetracyclo[8.7.0.03,8.011,15]heptadec-3(8)-en-9-one 2D Structure of (1R,5R,7S,10S,11S)-5,7-dimethyl-2,6-dioxa-15-azatetracyclo[8.7.0.03,8.011,15]heptadec-3(8)-en-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/1r5r7s10s11s-57-dimethyl-26-dioxa-15-azatetracyclo87003801115heptadec-38-en-9-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.44% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.75% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 88.79% | 98.95% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 88.50% | 86.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.91% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.28% | 95.89% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 87.19% | 98.46% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.97% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.57% | 94.45% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.96% | 93.04% |
CHEMBL3384 | Q16512 | Protein kinase N1 | 84.12% | 80.71% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 83.66% | 82.38% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.22% | 99.18% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.94% | 92.50% |
CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 82.75% | 99.29% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.46% | 93.40% |
CHEMBL4072 | P07858 | Cathepsin B | 80.38% | 93.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Elaeocarpus angustifolius |
PubChem | 162870125 |
LOTUS | LTS0094110 |
wikiData | Q105158628 |