(1R,3R,7S,8R)-N,N-dimethyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine
| Internal ID | 466baf64-ec37-4fe8-b363-be7112b2144c |
| Taxonomy | Alkaloids and derivatives > Loline alkaloids and derivatives |
| IUPAC Name | (1R,3R,7S,8R)-N,N-dimethyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine |
| SMILES (Canonical) | CN(C)C1C2CN3C1C(O2)CC3 |
| SMILES (Isomeric) | CN(C)[C@H]1[C@H]2CN3[C@@H]1[C@H](O2)CC3 |
| InChI | InChI=1S/C9H16N2O/c1-10(2)8-7-5-11-4-3-6(12-7)9(8)11/h6-9H,3-5H2,1-2H3/t6-,7-,8+,9-/m1/s1 |
| InChI Key | FIWXXQWEVIQSAB-LURQLKTLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.126263138 g/mol |
| Topological Polar Surface Area (TPSA) | 15.70 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
![2D Structure of (1R,3R,7S,8R)-N,N-dimethyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine](https://plantaedb.com/storage/docs/compounds/2023/11/1r3r7s8r-nn-dimethyl-2-oxa-6-azatricyclo421037nonan-8-amine.jpg "2D Structure of (1R,3R,7S,8R)-N,N-dimethyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.73% | 96.09% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 89.02% | 98.77% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.83% | 97.25% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 84.82% | 94.78% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 84.61% | 92.38% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 83.18% | 97.47% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.34% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.92% | 97.09% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.76% | 98.46% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.56% | 98.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.54% | 90.08% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 80.01% | 98.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Argyreia mollis |
| Lolium temulentum |
| PubChem | 101613942 |
| LOTUS | LTS0080075 |
| wikiData | Q104375930 |