(1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoxy]cyclohexane-1-carboxylic acid
| Internal ID | ffcb145b-b5af-420c-a992-7e01473a8b25 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Cyclitols and derivatives > Quinic acids and derivatives |
| IUPAC Name | (1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoxy]cyclohexane-1-carboxylic acid |
| SMILES (Canonical) | C1C(C(C(CC1(C(=O)O)O)OCC=CC2=CC=C(C=C2)O)O)O |
| SMILES (Isomeric) | C1[C@H]([C@@H]([C@@H](C[C@]1(C(=O)O)O)OCC=CC2=CC=C(C=C2)O)O)O |
| InChI | InChI=1S/C16H20O7/c17-11-5-3-10(4-6-11)2-1-7-23-13-9-16(22,15(20)21)8-12(18)14(13)19/h1-6,12-14,17-19,22H,7-9H2,(H,20,21)/t12-,13-,14+,16-/m1/s1 |
| InChI Key | MJRRVXXKDXXMHS-HGTKMLMNSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.12090297 g/mol |
| Topological Polar Surface Area (TPSA) | 127.00 Ų |
| XlogP | -0.10 |
| There are no found synonyms. |
![2D Structure of (1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoxy]cyclohexane-1-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/1r3r4s5r-134-trihydroxy-5-3-4-hydroxyphenylprop-2-enoxycyclohexane-1-carboxylic-acid.jpg "2D Structure of (1R,3R,4S,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoxy]cyclohexane-1-carboxylic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.18% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.08% | 96.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.66% | 94.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.26% | 94.45% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 92.60% | 91.71% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 91.80% | 94.23% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 90.89% | 94.97% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.18% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.49% | 95.56% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.26% | 94.08% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.88% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.37% | 89.00% |
| CHEMBL3194 | P02766 | Transthyretin | 84.19% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.42% | 86.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.82% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.65% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vaccinium dunalianum |
| PubChem | 162926018 |
| LOTUS | LTS0132239 |
| wikiData | Q105165613 |