(1R,3E,7E,11R)-3,7,10,10-tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-diene
Internal ID | 9d40cfe7-dbd4-4887-ae0f-2e42596a019a |
Taxonomy | Organoheterocyclic compounds > Epoxides |
IUPAC Name | (1R,3E,7E,11R)-3,7,10,10-tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-diene |
SMILES (Canonical) | CC1=CCC(C2C(O2)CC(=CCC1)C)(C)C |
SMILES (Isomeric) | C/C/1=C\CC([C@@H]2[C@H](O2)C/C(=C/CC1)/C)(C)C |
InChI | InChI=1S/C15H24O/c1-11-6-5-7-12(2)10-13-14(16-13)15(3,4)9-8-11/h7-8,13-14H,5-6,9-10H2,1-4H3/b11-8+,12-7+/t13-,14+/m1/s1 |
InChI Key | WSIKWSKUPSHZMF-DWTDZOANSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24O |
Molecular Weight | 220.35 g/mol |
Exact Mass | 220.182715385 g/mol |
Topological Polar Surface Area (TPSA) | 12.50 Ų |
XlogP | 3.50 |
There are no found synonyms. |
![2D Structure of (1R,3E,7E,11R)-3,7,10,10-tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-diene 2D Structure of (1R,3E,7E,11R)-3,7,10,10-tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-diene](https://plantaedb.com/storage/docs/compounds/2023/11/1r3e7e11r-371010-tetramethyl-12-oxabicyclo910dodeca-37-diene.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.16% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.11% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.93% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.81% | 95.56% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.25% | 93.40% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.70% | 97.79% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.98% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.42% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.39% | 90.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.34% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.80% | 86.33% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.48% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helichrysum petiolare |
PubChem | 15647025 |
LOTUS | LTS0209408 |
wikiData | Q105311875 |