(1R)-1-Ethenylhexyl beta-D-glucopyranoside
| Internal ID | 1ff6221f-81a6-47d6-af65-b621f0a97eab |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(3R)-oct-1-en-3-yl]oxyoxane-3,4,5-triol |
| SMILES (Canonical) | CCCCCC(C=C)OC1C(C(C(C(O1)CO)O)O)O |
| SMILES (Isomeric) | CCCCC[C@H](C=C)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| InChI | InChI=1S/C14H26O6/c1-3-5-6-7-9(4-2)19-14-13(18)12(17)11(16)10(8-15)20-14/h4,9-18H,2-3,5-8H2,1H3/t9-,10+,11+,12-,13+,14+/m0/s1 |
| InChI Key | MPSRBJBPHXIOFN-GMDXDWKASA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 99.40 Ų |
| XlogP | 1.00 |
| (1R)-1-Ethenylhexyl beta-D-glucopyranoside |
| 3-O-beta-d-glucopyranosyl (3r)-1-octen-3-ol |
| 209863-00-3 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.93% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.82% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.43% | 98.95% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 93.09% | 85.94% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.49% | 92.86% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.12% | 97.29% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.31% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.19% | 91.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.60% | 96.61% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.31% | 93.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.43% | 94.73% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.46% | 100.00% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 83.00% | 99.43% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 82.75% | 87.45% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 82.53% | 92.08% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.37% | 91.81% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.29% | 91.24% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.49% | 97.79% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.96% | 95.89% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.96% | 82.50% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.75% | 93.31% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.57% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Meehania urticifolia |
| Mentha spicata |
| PubChem | 97301592 |
| LOTUS | LTS0138188 |
| wikiData | Q105169719 |