(1R)-1-(1-methoxy-3-methylcarbazol-9-yl)-3,3,5-trimethyl-2,11-dihydro-1H-pyrano[3,2-a]carbazole
| Internal ID | 02aca7c8-a996-490a-92b4-b266ad72d34d |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | (1R)-1-(1-methoxy-3-methylcarbazol-9-yl)-3,3,5-trimethyl-2,11-dihydro-1H-pyrano[3,2-a]carbazole |
| SMILES (Canonical) | CC1=CC2=C(C(=C1)OC)N(C3=CC=CC=C32)C4CC(OC5=C4C6=C(C=C5C)C7=CC=CC=C7N6)(C)C |
| SMILES (Isomeric) | CC1=CC2=C(C(=C1)OC)N(C3=CC=CC=C32)[C@@H]4CC(OC5=C4C6=C(C=C5C)C7=CC=CC=C7N6)(C)C |
| InChI | InChI=1S/C32H30N2O2/c1-18-14-23-21-11-7-9-13-25(21)34(30(23)27(15-18)35-5)26-17-32(3,4)36-31-19(2)16-22-20-10-6-8-12-24(20)33-29(22)28(26)31/h6-16,26,33H,17H2,1-5H3/t26-/m1/s1 |
| InChI Key | POXYZXVGPKURCV-AREMUKBSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H30N2O2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.230728204 g/mol |
| Topological Polar Surface Area (TPSA) | 39.20 Ų |
| XlogP | 7.90 |
| There are no found synonyms. |
![2D Structure of (1R)-1-(1-methoxy-3-methylcarbazol-9-yl)-3,3,5-trimethyl-2,11-dihydro-1H-pyrano[3,2-a]carbazole](https://plantaedb.com/storage/docs/compounds/2023/11/1r-1-1-methoxy-3-methylcarbazol-9-yl-335-trimethyl-211-dihydro-1h-pyrano32-acarbazole.jpg "2D Structure of (1R)-1-(1-methoxy-3-methylcarbazol-9-yl)-3,3,5-trimethyl-2,11-dihydro-1H-pyrano[3,2-a]carbazole")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.42% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.97% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.99% | 95.56% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 95.11% | 92.98% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.83% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.60% | 93.99% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.67% | 97.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.66% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.24% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.93% | 98.95% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.89% | 89.62% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 90.54% | 85.49% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 87.99% | 89.44% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.54% | 94.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.52% | 91.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.26% | 97.09% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.20% | 82.38% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.76% | 98.75% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.04% | 98.59% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.01% | 95.56% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.70% | 96.39% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.53% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bergera euchrestifolia |
| PubChem | 163195436 |
| LOTUS | LTS0042071 |
| wikiData | Q105212741 |