4,5-Dihydroxy-6-[[4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-8a-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid
Internal ID | 733cad91-389b-437d-b02b-d5f52102589d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | 4,5-dihydroxy-6-[[4-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-8a-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)CO)OC6C(C(C(C(O6)C(=O)O)OC7C(C(C(CO7)O)O)O)O)O)C)C)C2C1)C)C(=O)OC8C(C(C(C(O8)CO)O)O)O)C |
SMILES (Isomeric) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)CO)OC6C(C(C(C(O6)C(=O)O)OC7C(C(C(CO7)O)O)O)O)O)C)C)C2C1)C)C(=O)OC8C(C(C(C(O8)CO)O)O)O)C |
InChI | InChI=1S/C47H74O19/c1-42(2)13-15-47(41(60)66-39-33(56)30(53)29(52)24(18-48)62-39)16-14-45(5)21(22(47)17-42)7-8-26-43(3)11-10-27(44(4,20-49)25(43)9-12-46(26,45)6)63-40-34(57)31(54)35(36(65-40)37(58)59)64-38-32(55)28(51)23(50)19-61-38/h7,22-36,38-40,48-57H,8-20H2,1-6H3,(H,58,59) |
InChI Key | UFRNMHBOQHSFSI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C47H74O19 |
Molecular Weight | 943.10 g/mol |
Exact Mass | 942.48243013 g/mol |
Topological Polar Surface Area (TPSA) | 312.00 Ų |
XlogP | 1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.76% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.19% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.55% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.45% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.34% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.68% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.20% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.60% | 89.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.46% | 95.50% |
CHEMBL2581 | P07339 | Cathepsin D | 84.15% | 98.95% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.58% | 97.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.27% | 99.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.89% | 100.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.83% | 95.17% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.59% | 96.77% |
CHEMBL5028 | O14672 | ADAM10 | 82.44% | 97.50% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.20% | 86.92% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.18% | 94.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.16% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.93% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.84% | 91.07% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.57% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aralia cordata |
Salsola micranthera |
PubChem | 162991319 |
LOTUS | LTS0078314 |
wikiData | Q105272059 |