[(3S,4aR,6aR,6bS,8aR,12aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | e51cd095-30bc-447e-884b-61503fe9be3c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(3S,4aR,6aR,6bS,8aR,12aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC(=O)C=CC6=CC=C(C=C6)O)C)C)C2C1)C)C)C |
SMILES (Isomeric) | C[C@@]12CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OC(=O)/C=C/C6=CC=C(C=C6)O)C)C)[C@@H]1CC(CC2)(C)C)C |
InChI | InChI=1S/C39H56O3/c1-34(2)21-22-36(5)23-24-38(7)28(29(36)25-34)14-15-31-37(6)19-18-32(35(3,4)30(37)17-20-39(31,38)8)42-33(41)16-11-26-9-12-27(40)13-10-26/h9-14,16,29-32,40H,15,17-25H2,1-8H3/b16-11+/t29-,30-,31+,32-,36+,37-,38+,39+/m0/s1 |
InChI Key | FFDJUOCBIYIQHJ-JWULUACBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H56O3 |
Molecular Weight | 572.90 g/mol |
Exact Mass | 572.42294564 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 11.50 |
There are no found synonyms. |
![2D Structure of [(3S,4aR,6aR,6bS,8aR,12aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [(3S,4aR,6aR,6bS,8aR,12aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/1e0f9460-855a-11ee-bff2-c9f562b5c6ed.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.69% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.13% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.26% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.45% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.29% | 95.56% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 91.71% | 97.64% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.81% | 93.99% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.37% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.30% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 85.67% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.46% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.11% | 89.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.74% | 92.94% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.71% | 91.71% |
CHEMBL3194 | P02766 | Transthyretin | 80.75% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acacia linarioides |
Casuarina equisetifolia |
PubChem | 10650760 |
LOTUS | LTS0062423 |
wikiData | Q104994369 |