5-Hydroxy-6-(6-hydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)-2-methylhept-2-enoic acid
Internal ID | 76758a97-b236-4e06-b095-67ba9e47f2ba |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | 5-hydroxy-6-(6-hydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)-2-methylhept-2-enoic acid |
SMILES (Canonical) | CC(C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C)C(CC=C(C)C(=O)O)O |
SMILES (Isomeric) | CC(C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C)C(CC=C(C)C(=O)O)O |
InChI | InChI=1S/C30H48O4/c1-18(25(33)34)7-8-21(31)19(2)20-11-13-28(6)23-10-9-22-26(3,4)24(32)12-14-29(22)17-30(23,29)16-15-27(20,28)5/h7,19-24,31-32H,8-17H2,1-6H3,(H,33,34) |
InChI Key | WCKMOTWOWWZGCU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O4 |
Molecular Weight | 472.70 g/mol |
Exact Mass | 472.35526001 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 7.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.23% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.67% | 96.09% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 94.61% | 95.69% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.82% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.57% | 98.95% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 91.51% | 98.75% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.72% | 93.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.65% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.62% | 91.19% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.21% | 96.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.68% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.19% | 90.17% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.67% | 96.38% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.81% | 97.09% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.08% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.57% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mangifera indica |
PubChem | 72729873 |
LOTUS | LTS0030962 |
wikiData | Q105301826 |