1beta,10beta-Epoxy-6beta-isobutyryloxy-9-oxofuranoeremophilane
Internal ID | 01974a96-fb2e-4812-b34d-c9f3cd9844fb |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | (6,9,10-trimethyl-2-oxo-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-8-yl) 2-methylpropanoate |
SMILES (Canonical) | CC1CCC2C3(C1(C(C4=C(C3=O)OC=C4C)OC(=O)C(C)C)C)O2 |
SMILES (Isomeric) | CC1CCC2C3(C1(C(C4=C(C3=O)OC=C4C)OC(=O)C(C)C)C)O2 |
InChI | InChI=1S/C19H24O5/c1-9(2)17(21)23-16-13-10(3)8-22-14(13)15(20)19-12(24-19)7-6-11(4)18(16,19)5/h8-9,11-12,16H,6-7H2,1-5H3 |
InChI Key | WNPQEVZAOIQRLM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H24O5 |
Molecular Weight | 332.40 g/mol |
Exact Mass | 332.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 69.00 Ų |
XlogP | 3.50 |
There are no found synonyms. |
![2D Structure of 1beta,10beta-Epoxy-6beta-isobutyryloxy-9-oxofuranoeremophilane 2D Structure of 1beta,10beta-Epoxy-6beta-isobutyryloxy-9-oxofuranoeremophilane](https://plantaedb.com/storage/docs/compounds/2023/11/1beta10beta-epoxy-6beta-isobutyryloxy-9-oxofuranoeremophilane.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.92% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.49% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.46% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.24% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.75% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.42% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 85.59% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.94% | 91.19% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.83% | 92.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.52% | 99.23% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.33% | 94.75% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.26% | 94.80% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.30% | 94.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.18% | 92.50% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.35% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.01% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligularia cyathiceps |
Ligularia fischeri |
Pittocaulon praecox |
Senecio caudatus |
PubChem | 14830751 |
LOTUS | LTS0056604 |
wikiData | Q105309213 |