1,9,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol
| Internal ID | 0c378793-8ee4-4af2-a516-a94a3ea07e80 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 1,9,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol |
| SMILES (Canonical) | COC1=C(C=C2C(=C1)CC3C4=C2C(=C(C=C4CCN3)O)OC)OC |
| SMILES (Isomeric) | COC1=C(C=C2C(=C1)CC3C4=C2C(=C(C=C4CCN3)O)OC)OC |
| InChI | InChI=1S/C19H21NO4/c1-22-15-8-11-6-13-17-10(4-5-20-13)7-14(21)19(24-3)18(17)12(11)9-16(15)23-2/h7-9,13,20-21H,4-6H2,1-3H3 |
| InChI Key | WESNQFFZIKGVLU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 60.00 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of 1,9,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1910-trimethoxy-566a7-tetrahydro-4h-dibenzodegquinolin-2-ol.jpg "2D Structure of 1,9,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.32% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.89% | 96.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 95.67% | 91.79% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 95.66% | 92.94% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.67% | 91.49% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 92.47% | 88.48% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 92.04% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.92% | 97.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.81% | 93.99% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 90.80% | 95.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.68% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.41% | 90.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.97% | 96.21% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.39% | 99.17% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 87.60% | 92.68% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.05% | 86.33% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.02% | 91.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.70% | 95.89% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 84.48% | 98.11% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.08% | 96.95% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 84.02% | 91.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.93% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.65% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.39% | 89.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.84% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cassytha filiformis |
| PubChem | 72383200 |
| LOTUS | LTS0148700 |
| wikiData | Q105303473 |