1,8,10-Trihydroxy-3-methyl-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-9-one
Internal ID | 232f0c43-9c20-4a9f-9367-02ddab51d892 |
Taxonomy | Benzenoids > Anthracenes |
IUPAC Name | 1,8,10-trihydroxy-3-methyl-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-9-one |
SMILES (Canonical) | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2(O)OC4C(C(C(C(O4)CO)O)O)O)C=CC=C3O |
SMILES (Isomeric) | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2(O)OC4C(C(C(C(O4)CO)O)O)O)C=CC=C3O |
InChI | InChI=1S/C21H22O10/c1-8-5-10-15(12(24)6-8)17(26)14-9(3-2-4-11(14)23)21(10,29)31-20-19(28)18(27)16(25)13(7-22)30-20/h2-6,13,16,18-20,22-25,27-29H,7H2,1H3 |
InChI Key | VISJSUMTZRQQFX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O10 |
Molecular Weight | 434.40 g/mol |
Exact Mass | 434.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 177.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.75% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.67% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.74% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 94.83% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.57% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.67% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.43% | 86.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.33% | 94.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.77% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.44% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.98% | 99.23% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.91% | 91.24% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.41% | 93.18% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 81.32% | 96.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.31% | 96.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.15% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rheum australe |
PubChem | 163071940 |
LOTUS | LTS0170908 |
wikiData | Q105286995 |