1,8-Dihydroxy-3,6-dimethoxy-9H-xanthen-9-one
| Internal ID | cbf5f14b-707c-4d7a-a1e2-241e5a9e7690 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 1,8-dihydroxy-3,6-dimethoxyxanthen-9-one |
| SMILES (Canonical) | COC1=CC(=C2C(=C1)OC3=CC(=CC(=C3C2=O)O)OC)O |
| SMILES (Isomeric) | COC1=CC(=C2C(=C1)OC3=CC(=CC(=C3C2=O)O)OC)O |
| InChI | InChI=1S/C15H12O6/c1-19-7-3-9(16)13-11(5-7)21-12-6-8(20-2)4-10(17)14(12)15(13)18/h3-6,16-17H,1-2H3 |
| InChI Key | AEUSBLWMURRGLG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 2.70 |
| 1,8-DIHYDROXY-3,6-DIMETHOXY-9H-XANTHEN-9-ONE |
| DTXSID30550705 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.09% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.35% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.50% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.17% | 85.14% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.35% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.61% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.29% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.11% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.10% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.98% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.89% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.11% | 86.33% |
| CHEMBL3194 | P02766 | Transthyretin | 83.65% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.47% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.55% | 99.23% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.52% | 93.65% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.13% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Schenkia spicata |
| PubChem | 13831944 |
| LOTUS | LTS0122728 |
| wikiData | Q82430133 |