1,8-dihydroxy-3-methoxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-10H-anthracen-9-one
Internal ID | 43617c76-249d-4d66-a2b9-4472aee21b5b |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 1,8-dihydroxy-3-methoxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-10H-anthracen-9-one |
SMILES (Canonical) | COC1=CC2=C(C(=C1)O)C(=O)C3=C(C=CC(=C3C2)OC4C(C(C(C(O4)CO)O)O)O)O |
SMILES (Isomeric) | COC1=CC2=C(C(=C1)O)C(=O)C3=C(C=CC(=C3C2)OC4C(C(C(C(O4)CO)O)O)O)O |
InChI | InChI=1S/C21H22O10/c1-29-9-4-8-5-10-13(30-21-20(28)19(27)17(25)14(7-22)31-21)3-2-11(23)16(10)18(26)15(8)12(24)6-9/h2-4,6,14,17,19-25,27-28H,5,7H2,1H3 |
InChI Key | IPGXIZABQUBQSI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O10 |
Molecular Weight | 434.40 g/mol |
Exact Mass | 434.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 1.00 |
There are no found synonyms. |
![2D Structure of 1,8-dihydroxy-3-methoxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-10H-anthracen-9-one 2D Structure of 1,8-dihydroxy-3-methoxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-10H-anthracen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/18-dihydroxy-3-methoxy-5-345-trihydroxy-6-hydroxymethyloxan-2-yloxy-10h-anthracen-9-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.26% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.87% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.09% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.62% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.30% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.18% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.10% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.09% | 99.15% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.05% | 96.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.00% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.94% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.94% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.52% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.81% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.93% | 94.45% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.52% | 91.49% |
CHEMBL220 | P22303 | Acetylcholinesterase | 82.67% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 80.39% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.32% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.27% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.08% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Swertia japonica |
PubChem | 162850790 |
LOTUS | LTS0157784 |
wikiData | Q105117248 |