6-[[8-Acetyloxy-4-formyl-9-hydroxy-8a-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-10-(2-methylbut-2-enoyloxy)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[5,6-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Internal ID | fdad08f4-55c2-45cd-a5ef-b70a0d85cdd3 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | 6-[[8-acetyloxy-4-formyl-9-hydroxy-8a-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-10-(2-methylbut-2-enoyloxy)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[5,6-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC=C(C)C(=O)OC1C(C2(C(CC1(C)C)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2OC(=O)C)C)C)(C)C=O)OC6C(C(C(C(O6)C(=O)O)O)OC7C(CC(C(O7)O)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C)CO)O |
SMILES (Isomeric) | CC=C(C)C(=O)OC1C(C2(C(CC1(C)C)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2OC(=O)C)C)C)(C)C=O)OC6C(C(C(C(O6)C(=O)O)O)OC7C(CC(C(O7)O)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C)CO)O |
InChI | InChI=1S/C59H90O27/c1-10-24(2)48(75)85-46-45(72)59(23-62)27(18-54(46,4)5)26-11-12-33-55(6)15-14-34(56(7,22-61)32(55)13-16-57(33,8)58(26,9)19-35(59)78-25(3)63)81-53-44(84-52-40(70)38(68)37(67)31(20-60)80-52)42(41(71)43(83-53)47(73)74)82-50-30(17-28(64)49(76)86-50)79-51-39(69)36(66)29(65)21-77-51/h10-11,22,27-46,49-53,60,62,64-72,76H,12-21,23H2,1-9H3,(H,73,74) |
InChI Key | VXOANOIARFXBDR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C59H90O27 |
Molecular Weight | 1231.30 g/mol |
Exact Mass | 1230.56694759 g/mol |
Topological Polar Surface Area (TPSA) | 424.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.25% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.15% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.35% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.35% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.52% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.83% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.76% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 88.97% | 98.95% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.55% | 93.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.80% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.63% | 97.25% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.54% | 94.08% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.90% | 95.89% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.36% | 95.50% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.24% | 95.50% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.95% | 91.24% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.24% | 94.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.71% | 91.07% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.36% | 95.93% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 82.24% | 94.23% |
CHEMBL5028 | O14672 | ADAM10 | 82.20% | 97.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.09% | 97.14% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.92% | 96.77% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.76% | 92.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.73% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.40% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camellia sinensis |
PubChem | 163048494 |
LOTUS | LTS0048161 |
wikiData | Q105298628 |