methyl (2R)-2-[(1R,2S,5R,6R,11R,13S,14R,16S)-6-(furan-3-yl)-14-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-9-en-16-yl]-2-hydroxyacetate
Internal ID | 05ccc27b-7cb9-46c3-83e8-c84134cf89ee |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | methyl (2R)-2-[(1R,2S,5R,6R,11R,13S,14R,16S)-6-(furan-3-yl)-14-hydroxy-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-9-en-16-yl]-2-hydroxyacetate |
SMILES (Canonical) | CC1(C(C2CC3C(CCC4(C3=CC(=O)OC4C5=COC=C5)C)C(C1C(C(=O)OC)O)(C2=O)C)O)C |
SMILES (Isomeric) | C[C@@]12CC[C@H]3[C@H](C1=CC(=O)O[C@H]2C4=COC=C4)C[C@H]5[C@H](C([C@@H]([C@@]3(C5=O)C)[C@H](C(=O)OC)O)(C)C)O |
InChI | InChI=1S/C27H34O8/c1-25(2)20(19(29)24(32)33-5)27(4)16-6-8-26(3)17(14(16)10-15(21(25)30)22(27)31)11-18(28)35-23(26)13-7-9-34-12-13/h7,9,11-12,14-16,19-21,23,29-30H,6,8,10H2,1-5H3/t14-,15+,16+,19-,20+,21-,23+,26-,27-/m1/s1 |
InChI Key | OAGAPNRITMWLKW-DROLRUCHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H34O8 |
Molecular Weight | 486.60 g/mol |
Exact Mass | 486.22536804 g/mol |
Topological Polar Surface Area (TPSA) | 123.00 Ų |
XlogP | 2.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.93% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.92% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.88% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.32% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.22% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.00% | 90.17% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.03% | 97.25% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.45% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.82% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.33% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.85% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.71% | 95.89% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.69% | 96.38% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.98% | 91.19% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.68% | 94.33% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.59% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.49% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.99% | 90.71% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.96% | 97.14% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.56% | 95.71% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.65% | 82.69% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.14% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albizia procera |
Cedrela odorata |
Swietenia macrophylla |
PubChem | 21672225 |
LOTUS | LTS0276094 |
wikiData | Q105188649 |