1,7-Dihydroxy-6-methoxy-9H-xanthen-9-one
| Internal ID | 952c5c3d-f55a-48e3-b40a-fac87c88f36e |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 1,7-dihydroxy-6-methoxyxanthen-9-one |
| SMILES (Canonical) | COC1=C(C=C2C(=C1)OC3=CC=CC(=C3C2=O)O)O |
| SMILES (Isomeric) | COC1=C(C=C2C(=C1)OC3=CC=CC(=C3C2=O)O)O |
| InChI | InChI=1S/C14H10O5/c1-18-12-6-11-7(5-9(12)16)14(17)13-8(15)3-2-4-10(13)19-11/h2-6,15-16H,1H3 |
| InChI Key | JYWKUFVGSWRHFD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.05282342 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 2.80 |
| 42833-91-0 |
| DTXSID80785464 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.51% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.57% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.80% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.35% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.61% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.81% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.06% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.44% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.40% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.40% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.56% | 94.45% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.15% | 90.20% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.92% | 94.03% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.58% | 99.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.06% | 85.14% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.69% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hypericum monogynum |
| PubChem | 71361808 |
| LOTUS | LTS0015986 |
| wikiData | Q82751167 |