1,7-Dihydroxy-5,6-dimethoxy-9h-xanthen-9-one
| Internal ID | 0ac89f45-cb68-482d-8950-47cbe0525eb1 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 1,7-dihydroxy-5,6-dimethoxyxanthen-9-one |
| SMILES (Canonical) | COC1=C(C=C2C(=C1OC)OC3=CC=CC(=C3C2=O)O)O |
| SMILES (Isomeric) | COC1=C(C=C2C(=C1OC)OC3=CC=CC(=C3C2=O)O)O |
| InChI | InChI=1S/C15H12O6/c1-19-14-9(17)6-7-12(18)11-8(16)4-3-5-10(11)21-13(7)15(14)20-2/h3-6,16-17H,1-2H3 |
| InChI Key | NIVJJXNAMAVPQW-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.14% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.23% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.60% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.42% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.68% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.61% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.29% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.76% | 99.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.68% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.96% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.36% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.00% | 99.15% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.13% | 83.82% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.36% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hypericum monogynum |
| PubChem | 90993927 |
| LOTUS | LTS0069315 |
| wikiData | Q105180009 |