(6R)-8,10-dihydroxy-3-methoxy-9-[(E)-3-methylbut-1-enyl]-6-(2-methylprop-1-enyl)-6H-chromeno[4,3-b]chromen-7-one
Internal ID | 414966da-a957-42b1-a829-cdad63eb8693 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
IUPAC Name | (6R)-8,10-dihydroxy-3-methoxy-9-[(E)-3-methylbut-1-enyl]-6-(2-methylprop-1-enyl)-6H-chromeno[4,3-b]chromen-7-one |
SMILES (Canonical) | CC(C)C=CC1=C(C2=C(C=C1O)OC3=C(C2=O)C(OC4=C3C=CC(=C4)OC)C=C(C)C)O |
SMILES (Isomeric) | CC(C)/C=C/C1=C(C2=C(C=C1O)OC3=C(C2=O)[C@H](OC4=C3C=CC(=C4)OC)C=C(C)C)O |
InChI | InChI=1S/C26H26O6/c1-13(2)6-8-16-18(27)12-21-22(24(16)28)25(29)23-20(10-14(3)4)31-19-11-15(30-5)7-9-17(19)26(23)32-21/h6-13,20,27-28H,1-5H3/b8-6+/t20-/m1/s1 |
InChI Key | FUOITKFXHPXSCA-CPSHHHPTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H26O6 |
Molecular Weight | 434.50 g/mol |
Exact Mass | 434.17293854 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 6.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.22% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.71% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 96.55% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.51% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.03% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.37% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.48% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.72% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.35% | 96.00% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 84.67% | 83.10% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.67% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.36% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.74% | 90.71% |
CHEMBL3194 | P02766 | Transthyretin | 83.12% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.05% | 86.33% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.59% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.52% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.32% | 99.17% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.19% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus chama |
Artocarpus heterophyllus |
Artocarpus hypargyreus |
PubChem | 162972402 |
LOTUS | LTS0103721 |
wikiData | Q105001870 |