[(2S,3S,4S,5R,6S)-4-acetyloxy-5-hydroxy-6-[[(1R,2S,4S,5S,6S,10R)-2-(hydroxymethyl)-10-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-2-methyloxan-3-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate
Internal ID | 94dc53dc-017f-4c65-ac96-89155a08e785 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters |
IUPAC Name | [(2S,3S,4S,5R,6S)-4-acetyloxy-5-hydroxy-6-[[(1R,2S,4S,5S,6S,10R)-2-(hydroxymethyl)-10-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-2-methyloxan-3-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)O)OC(=O)C)OC(=O)C=CC6=CC=C(C=C6)OC |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@H]3C=CO[C@@H]([C@H]3[C@@]4([C@H]2O4)CO)O[C@@H]5[C@H]([C@@H]([C@@H]([C@@H](O5)CO)O)O)O)O)OC(=O)C)OC(=O)/C=C/C6=CC=C(C=C6)OC |
InChI | InChI=1S/C33H42O17/c1-14-26(47-20(37)9-6-16-4-7-17(42-3)8-5-16)28(45-15(2)36)25(41)32(44-14)48-27-18-10-11-43-30(21(18)33(13-35)29(27)50-33)49-31-24(40)23(39)22(38)19(12-34)46-31/h4-11,14,18-19,21-32,34-35,38-41H,12-13H2,1-3H3/b9-6+/t14-,18-,19-,21-,22+,23+,24-,25+,26-,27-,28-,29-,30+,31+,32-,33+/m0/s1 |
InChI Key | VORMEQNHMJOLMM-HXMVLMOXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H42O17 |
Molecular Weight | 710.70 g/mol |
Exact Mass | 710.24219987 g/mol |
Topological Polar Surface Area (TPSA) | 242.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.45% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.16% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.62% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.49% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.18% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.87% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.32% | 89.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.67% | 86.92% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.91% | 97.36% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.81% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.75% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.37% | 94.73% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 85.69% | 87.67% |
CHEMBL2581 | P07339 | Cathepsin D | 84.85% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.35% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.62% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.29% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.80% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.56% | 95.93% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 80.40% | 81.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Buddleja japonica |
Scrophularia nodosa |
PubChem | 162911784 |
LOTUS | LTS0051898 |
wikiData | Q105290372 |