1,5-Dimethoxy-3-[2-(4-methoxyphenyl)ethenyl]-2-(3-methylbut-2-enyl)benzene
| Internal ID | e71ed4e5-2f17-433c-a344-ca4db500120e |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 1,5-dimethoxy-3-[2-(4-methoxyphenyl)ethenyl]-2-(3-methylbut-2-enyl)benzene |
| SMILES (Canonical) | CC(=CCC1=C(C=C(C=C1OC)OC)C=CC2=CC=C(C=C2)OC)C |
| SMILES (Isomeric) | CC(=CCC1=C(C=C(C=C1OC)OC)C=CC2=CC=C(C=C2)OC)C |
| InChI | InChI=1S/C22H26O3/c1-16(2)6-13-21-18(14-20(24-4)15-22(21)25-5)10-7-17-8-11-19(23-3)12-9-17/h6-12,14-15H,13H2,1-5H3 |
| InChI Key | BDUQKWXSHWYDGX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18819469 g/mol |
| Topological Polar Surface Area (TPSA) | 27.70 Ų |
| XlogP | 6.00 |
| There are no found synonyms. |
![2D Structure of 1,5-Dimethoxy-3-[2-(4-methoxyphenyl)ethenyl]-2-(3-methylbut-2-enyl)benzene](https://plantaedb.com/storage/docs/compounds/2023/11/15-dimethoxy-3-2-4-methoxyphenylethenyl-2-3-methylbut-2-enylbenzene.jpg "2D Structure of 1,5-Dimethoxy-3-[2-(4-methoxyphenyl)ethenyl]-2-(3-methylbut-2-enyl)benzene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 98.14% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.71% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.99% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.39% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.35% | 90.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.13% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.59% | 95.56% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 88.92% | 96.12% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.49% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.61% | 99.17% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.62% | 90.24% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.58% | 85.14% |
| CHEMBL3194 | P02766 | Transthyretin | 82.43% | 90.71% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.65% | 91.07% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.44% | 95.89% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.39% | 92.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.09% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Schoenus nigricans |
| Scirpoides holoschoenus |
| PubChem | 163034711 |
| LOTUS | LTS0079183 |
| wikiData | Q104924748 |