1,5-Dihydroxy-3,8-dimethoxy xanthone
Internal ID | d681b254-6821-4aee-b589-ee4cf55fe41d |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 1,5-dihydroxy-3,8-dimethoxyxanthen-9-one |
SMILES (Canonical) | COC1=C2C(=C(C=C1)O)OC3=CC(=CC(=C3C2=O)O)OC |
SMILES (Isomeric) | COC1=C2C(=C(C=C1)O)OC3=CC(=CC(=C3C2=O)O)OC |
InChI | InChI=1S/C15H12O6/c1-19-7-5-9(17)12-11(6-7)21-15-8(16)3-4-10(20-2)13(15)14(12)18/h3-6,16-17H,1-2H3 |
InChI Key | HCOBNXLXVQFNAR-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C15H12O6 |
Molecular Weight | 288.25 g/mol |
Exact Mass | 288.06338810 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 2.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.38% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.53% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.00% | 94.00% |
CHEMBL3194 | P02766 | Transthyretin | 93.56% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.03% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 89.61% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.43% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.98% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.63% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.50% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.38% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.23% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.84% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 83.64% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.96% | 94.73% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.10% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gentiana algida |
Swertia chirayta |
Swertia cuneata |
PubChem | 10356746 |
LOTUS | LTS0260443 |
wikiData | Q105025876 |