1,5-Dihydroxy-2-methoxy-6-methylanthraquinone
Internal ID | 5fdecc8d-d3b6-4f9d-b2cf-87274f6a01b6 |
Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
IUPAC Name | 1,5-dihydroxy-2-methoxy-6-methylanthracene-9,10-dione |
SMILES (Canonical) | CC1=C(C2=C(C=C1)C(=O)C3=C(C2=O)C=CC(=C3O)OC)O |
SMILES (Isomeric) | CC1=C(C2=C(C=C1)C(=O)C3=C(C2=O)C=CC(=C3O)OC)O |
InChI | InChI=1S/C16H12O5/c1-7-3-4-8-11(13(7)17)14(18)9-5-6-10(21-2)16(20)12(9)15(8)19/h3-6,17,20H,1-2H3 |
InChI Key | JJTIQZJKQCQNJK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H12O5 |
Molecular Weight | 284.26 g/mol |
Exact Mass | 284.06847348 g/mol |
Topological Polar Surface Area (TPSA) | 83.80 Ų |
XlogP | 3.60 |
CHEBI:174711 |
DTXSID401213876 |
1,5-Dihydroxy-2-methoxy-6-methyl-9,10-anthracenedione |
1,5-DIHYDROXY-2-METHOXY-6-METHYLANTHRACENE-9,10-DIONE |
63965-45-7 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.13% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 94.91% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.04% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.44% | 94.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.24% | 91.11% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.84% | 96.67% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.67% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.66% | 89.00% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 84.24% | 90.20% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.22% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 81.40% | 98.75% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.45% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Morinda citrifolia |
PubChem | 13412795 |
LOTUS | LTS0133474 |
wikiData | Q105129890 |