1,3,5-Trihydroxy-9,10-dioxoanthracene-2-carbaldehyde
| Internal ID | ad735cab-86ff-479e-a990-2338e7471444 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
| IUPAC Name | 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde |
| SMILES (Canonical) | C1=CC2=C(C(=C1)O)C(=O)C3=CC(=C(C(=C3C2=O)O)C=O)O |
| SMILES (Isomeric) | C1=CC2=C(C(=C1)O)C(=O)C3=CC(=C(C(=C3C2=O)O)C=O)O |
| InChI | InChI=1S/C15H8O6/c16-5-8-10(18)4-7-12(15(8)21)13(19)6-2-1-3-9(17)11(6)14(7)20/h1-5,17-18,21H |
| InChI Key | ZLTPIJXBXKYZKU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H8O6 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.03208797 g/mol |
| Topological Polar Surface Area (TPSA) | 112.00 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.98% | 91.49% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 98.39% | 98.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.33% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.60% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.24% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.81% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.07% | 94.73% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.88% | 93.40% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.73% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.85% | 98.75% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.84% | 93.03% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.59% | 90.24% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.18% | 99.23% |
| CHEMBL3194 | P02766 | Transthyretin | 81.51% | 90.71% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.30% | 83.10% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 80.64% | 88.00% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.39% | 83.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Corydalis yanhusuo |
| Damnacanthus major |
| PubChem | 5320212 |
| NPASS | NPC135322 |
| LOTUS | LTS0098236 |
| wikiData | Q105379161 |