1,3,5-Trihydroxy-6,7-dimethoxy-2-methylanthraquinone
| Internal ID | 9dc8ad7f-416e-410a-a23d-443b72d52c73 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
| IUPAC Name | 1,5,7-trihydroxy-2,3-dimethoxy-6-methylanthracene-9,10-dione |
| SMILES (Canonical) | CC1=C(C=C2C(=C1O)C(=O)C3=CC(=C(C(=C3C2=O)O)OC)OC)O |
| SMILES (Isomeric) | CC1=C(C=C2C(=C1O)C(=O)C3=CC(=C(C(=C3C2=O)O)OC)OC)O |
| InChI | InChI=1S/C17H14O7/c1-6-9(18)4-7-11(13(6)19)15(21)8-5-10(23-2)17(24-3)16(22)12(8)14(7)20/h4-5,18-19,22H,1-3H3 |
| InChI Key | RMPPFTPDOBBBQE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07395278 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | 3.20 |
| CHEBI:174452 |
| DTXSID201184007 |
| 1,3,5-Trihydroxy-6,7-dimethoxy-2-methyl-9,10-anthracenedione |
| 1,5,7-trihydroxy-2,3-dimethoxy-6-methylanthracene-9,10-dione |
| 38934-17-7 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.11% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.65% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.03% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.55% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.15% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.62% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.35% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.50% | 99.23% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.80% | 96.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.73% | 96.21% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.48% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.19% | 85.14% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.02% | 92.68% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.00% | 90.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.94% | 91.00% |
| CHEMBL3194 | P02766 | Transthyretin | 80.17% | 90.71% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 80.11% | 96.86% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.02% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Senna tora |
| PubChem | 131751404 |
| LOTUS | LTS0169125 |
| wikiData | Q105240974 |