2-[4-[6-[4-[3-[3,4-Dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dimethoxyphenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 964e15db-9771-48e9-b775-f442c08c16d5 |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | 2-[4-[6-[4-[3-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dimethoxyphenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=CC(=CC(=C1OC2C(C(C(C(O2)CO)O)O)O)OC)C3C4COC(C4CO3)C5=CC(=C(C(=C5)OC)OC6C(C(C(C(O6)CO)O)O)OC7C(C(CO7)(CO)O)O)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1OC2C(C(C(C(O2)CO)O)O)O)OC)C3C4COC(C4CO3)C5=CC(=C(C(=C5)OC)OC6C(C(C(C(O6)CO)O)O)OC7C(C(CO7)(CO)O)O)OC |
InChI | InChI=1S/C39H54O22/c1-50-19-5-15(6-20(51-2)32(19)59-36-29(47)27(45)25(43)23(9-40)57-36)30-17-11-55-31(18(17)12-54-30)16-7-21(52-3)33(22(8-16)53-4)60-37-34(28(46)26(44)24(10-41)58-37)61-38-35(48)39(49,13-42)14-56-38/h5-8,17-18,23-31,34-38,40-49H,9-14H2,1-4H3 |
InChI Key | RSLCDGJCFQIMTN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H54O22 |
Molecular Weight | 874.80 g/mol |
Exact Mass | 874.31067335 g/mol |
Topological Polar Surface Area (TPSA) | 313.00 Ų |
XlogP | -2.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.00% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.17% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.40% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.22% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.35% | 94.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.45% | 95.93% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.15% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.13% | 92.94% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.49% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.35% | 89.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.84% | 92.98% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.98% | 86.92% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.81% | 97.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.87% | 95.89% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.75% | 93.18% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.49% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.26% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.94% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.98% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.31% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.11% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.10% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.99% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albizia julibrissin |
PubChem | 162949443 |
LOTUS | LTS0180573 |
wikiData | Q105244722 |