13,26-Dimethyl-2,15-dioxa-12,25-diazatricyclo[22.2.2.2~11,14~]triacontane-3,16-dione
Internal ID | 2e859166-dabe-48b1-a375-43e71aa56a5b |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | 13,26-dimethyl-2,15-dioxa-12,25-diazatricyclo[22.2.2.211,14]triacontane-3,16-dione |
SMILES (Canonical) | CC1C2CCC(N1)CCCCCCCC(=O)OC3CCC(CCCCCCCC(=O)O2)NC3C |
SMILES (Isomeric) | CC1C2CCC(N1)CCCCCCCC(=O)OC3CCC(CCCCCCCC(=O)O2)NC3C |
InChI | InChI=1S/C28H50N2O4/c1-21-25-19-17-23(29-21)13-9-5-3-8-12-16-28(32)34-26-20-18-24(30-22(26)2)14-10-6-4-7-11-15-27(31)33-25/h21-26,29-30H,3-20H2,1-2H3 |
InChI Key | AMSCMASJCYVAIF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H50N2O4 |
Molecular Weight | 478.70 g/mol |
Exact Mass | 478.37705808 g/mol |
Topological Polar Surface Area (TPSA) | 76.70 Ų |
XlogP | 6.30 |
PD143306 |
FT-0776429 |
12,25-Diaza-13,26-dimethyl-2,15-dioxatricyclo[22.2.2.2<11,14>]triacontane-3,16-dione |
13,26-Dimethyl-2,15-dioxa-12,25-diazatricyclo[22.2.2.2~11,14~]triacontane-3,16-dione |
![2D Structure of 13,26-Dimethyl-2,15-dioxa-12,25-diazatricyclo[22.2.2.2~11,14~]triacontane-3,16-dione 2D Structure of 13,26-Dimethyl-2,15-dioxa-12,25-diazatricyclo[22.2.2.2~11,14~]triacontane-3,16-dione](https://plantaedb.com/storage/docs/compounds/2023/11/1326-dimethyl-215-dioxa-1225-diazatricyclo222221114triacontane-316-dione.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.92% | 97.25% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 92.44% | 96.38% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.66% | 97.09% |
CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 91.08% | 99.29% |
CHEMBL2581 | P07339 | Cathepsin D | 89.95% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.75% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.46% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.43% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.40% | 93.04% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 81.66% | 94.78% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.47% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carica papaya |
PubChem | 103019 |
LOTUS | LTS0019186 |
wikiData | Q104914908 |