13-Methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-2-one
| Internal ID | 21dfe2c4-f14a-4e93-a80c-007e73877535 |
| Taxonomy | Alkaloids and derivatives > Indolonaphthyridine alkaloids |
| IUPAC Name | 13-methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-2-one |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C4N2C(=O)CCC4=NC=C3 |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C4N2C(=O)CCC4=NC=C3 |
| InChI | InChI=1S/C15H12N2O2/c1-19-9-2-3-10-11-6-7-16-12-4-5-14(18)17(15(11)12)13(10)8-9/h2-3,6-8H,4-5H2,1H3 |
| InChI Key | HDYNDVCZJZFFHK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.089877630 g/mol |
| Topological Polar Surface Area (TPSA) | 44.10 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
![2D Structure of 13-Methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/13-methoxy-16-diazatetracyclo761051601015hexadeca-5791610151113-hexaen-2-one.jpg "2D Structure of 13-Methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.57% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.73% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.58% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.06% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.74% | 93.99% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 91.67% | 96.47% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.66% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.72% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.00% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.91% | 91.11% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 89.19% | 92.67% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.41% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.35% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.80% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.55% | 93.40% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.07% | 99.15% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 84.24% | 93.24% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.77% | 100.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.27% | 96.67% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.24% | 89.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.16% | 93.31% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.15% | 97.53% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.08% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eurycoma longifolia |
| PubChem | 162961074 |
| LOTUS | LTS0222112 |
| wikiData | Q105026674 |