1,3-Bis(p-hydroxyphenyl)pentane-1,4-diene
Internal ID | 679f78f7-aaf7-41db-9811-6d96cc86afc2 |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | 4-[3-(4-hydroxyphenyl)penta-1,4-dienyl]phenol |
SMILES (Canonical) | C=CC(C=CC1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
SMILES (Isomeric) | C=CC(C=CC1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
InChI | InChI=1S/C17H16O2/c1-2-14(15-7-11-17(19)12-8-15)6-3-13-4-9-16(18)10-5-13/h2-12,14,18-19H,1H2 |
InChI Key | VEAUNWQYYMXIRB-UHFFFAOYSA-N |
Popularity | 22 references in papers |
Molecular Formula | C17H16O2 |
Molecular Weight | 252.31 g/mol |
Exact Mass | 252.115029749 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 4.40 |
Hinokiresinol;alpha-(p-Hydroxystyryl)chavicol |
4-[3-(4-hydroxyphenyl)penta-1,4-dienyl]phenol |
SCHEMBL8416158 |
CHEBI:131953 |
4-[1-(4-hydroxyphenyl)penta-1,4-dien-3-yl]phenol |
Q27225320 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL242 | Q92731 | Estrogen receptor beta | 97.74% | 98.35% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.94% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.50% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 86.13% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.47% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.79% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.41% | 95.56% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.54% | 93.10% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.43% | 89.67% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.41% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anemarrhena asphodeloides |
Asparagus africanus |
Asparagus cochinchinensis |
Libocedrus yateensis |
Metasequoia glyptostroboides |
PubChem | 157288 |
LOTUS | LTS0180760 |
wikiData | Q27225320 |